About 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride
5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride (PubChem CID 51063958) has the molecular formula C7H9ClN2O2S
and a molecular weight of 220.68 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride.
Analyze 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The IUPAC name of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride (CID 51063958) is 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride.
What is the SMILES notation for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The canonical SMILES for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride is O=S(=O)(Cl)c1cnc2n1CCCC2.
What is the InChIKey of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
The InChIKey is WOCAAWOBBCHYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O2S/c8-13(11,12)7-5-9-6-3-1-2-4-10(6)7/h5H,1-4H2.
What are the key properties of 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride?
5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride has a molecular weight of 220.68 g/mol, XLogP of 1.15, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonyl chloride is sourced from PubChem (CID 51063958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).