About 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride
4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride (PubChem CID 51064152) has the molecular formula C4H6Cl2N2S
and a molecular weight of 185.08 g/mol. Its IUPAC name is 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride.
Molecular Properties
| Compound Name | 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride |
| PubChem CID | 51064152 |
| Molecular Formula | C4H6Cl2N2S |
| Molecular Weight | 185.08 g/mol |
| Exact Mass | 183.96 |
| IUPAC Name | 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride |
| SMILES | Nc1nc(CCl)cs1.[Cl-].[H+] |
| InChI | InChI=1S/C4H5ClN2S.ClH/c5-1-3-2-8-4(6)7-3;/h2H,1H2,(H2,6,7);1H |
| InChIKey | NMAKJOWVEDTHOA-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.08 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride?
The IUPAC name of 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride (CID 51064152) is 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride.
What is the SMILES notation for 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride?
The canonical SMILES for 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride is Nc1nc(CCl)cs1.[Cl-].[H+].
What is the InChIKey of 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride?
The InChIKey is NMAKJOWVEDTHOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5ClN2S.ClH/c5-1-3-2-8-4(6)7-3;/h2H,1H2,(H2,6,7);1H.
What are the key properties of 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride?
4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride has a molecular weight of 185.08 g/mol, XLogP of -1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-1,3-thiazol-2-amine;hydron;chloride is sourced from PubChem (CID 51064152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).