About 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide (PubChem CID 510647) has the molecular formula C19H20ClN3O4S
and a molecular weight of 421.91 g/mol. Its IUPAC name is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide |
| PubChem CID | 510647 |
| Molecular Formula | C19H20ClN3O4S |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)c2c(C(=O)NNCCO)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C19H20ClN3O4S/c1-11-7-12(2)9-14(8-11)28(26,27)18-15-10-13(20)3-4-16(15)22-17(18)19(25)23-21-5-6-24/h3-4,7-10,21-22,24H,5-6H2,1-2H3,(H,23,25) |
| InChIKey | XAOANWPRTZIZKN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide?
The IUPAC name of 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide (CID 510647) is 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide.
What is the SMILES notation for 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide?
The canonical SMILES for 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide is Cc1cc(C)cc(S(=O)(=O)c2c(C(=O)NNCCO)[nH]c3ccc(Cl)cc23)c1.
What is the InChIKey of 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide?
The InChIKey is XAOANWPRTZIZKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClN3O4S/c1-11-7-12(2)9-14(8-11)28(26,27)18-15-10-13(20)3-4-16(15)22-17(18)19(25)23-21-5-6-24/h3-4,7-10,21-22,24H,5-6H2,1-2H3,(H,23,25).
What are the key properties of 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide?
5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide has a molecular weight of 421.91 g/mol, XLogP of 2.50, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(3,5-dimethylphenyl)sulfonyl-N'-(2-hydroxyethyl)-1H-indole-2-carbohydrazide is sourced from PubChem (CID 510647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).