About 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile
2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile (PubChem CID 51065124) has the molecular formula C19H13N3O2S
and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile |
| PubChem CID | 51065124 |
| Molecular Formula | C19H13N3O2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile |
| SMILES | Cc1ccc(C2=N/C(=C3\Sc4ccccc4N3CC#N)C(=O)O2)cc1 |
| InChI | InChI=1S/C19H13N3O2S/c1-12-6-8-13(9-7-12)17-21-16(19(23)24-17)18-22(11-10-20)14-4-2-3-5-15(14)25-18/h2-9H,11H2,1H3/b18-16- |
| InChIKey | JBIAYRHVADRPES-VLGSPTGOSA-N |
| XLogP | 3.60 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile?
The IUPAC name of 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile (CID 51065124) is 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile.
What is the SMILES notation for 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile?
The canonical SMILES for 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile is Cc1ccc(C2=N/C(=C3\Sc4ccccc4N3CC#N)C(=O)O2)cc1.
What is the InChIKey of 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile?
The InChIKey is JBIAYRHVADRPES-VLGSPTGOSA-N. The full InChI is InChI=1S/C19H13N3O2S/c1-12-6-8-13(9-7-12)17-21-16(19(23)24-17)18-22(11-10-20)14-4-2-3-5-15(14)25-18/h2-9H,11H2,1H3/b18-16-.
What are the key properties of 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile?
2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile has a molecular weight of 347.40 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]-1,3-benzothiazol-3-yl]acetonitrile is sourced from PubChem (CID 51065124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).