C22H19N3O3 — CID 51065688
5-(4-ethoxyphenyl)-N-(8-methylquinolin-5-yl)-1,2-oxazole-3-carboxamide (PubChem CID 51065688) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-N-(8-methylquinolin-5-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(4-ethoxyphenyl)-N-(8-methylquinolin-5-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 51065688 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 5-(4-ethoxyphenyl)-N-(8-methylquinolin-5-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCOc1ccc(-c2cc(C(=O)Nc3ccc(C)c4ncccc34)no2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c1-3-27-16-9-7-15(8-10-16)20-13-19(25-28-20)22(26)24-18-11-6-14(2)21-17(18)5-4-12-23-21/h4-13H,3H2,1-2H3,(H,24,26) |
| InChIKey | SJFFXFQEWTTXLW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |