About (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one
(5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one (PubChem CID 51065871) has the molecular formula C21H19ClN2O2S
and a molecular weight of 398.92 g/mol. Its IUPAC name is (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
| PubChem CID | 51065871 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCCCC2)S/C1=C/c1ccc(Oc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H19ClN2O2S/c22-18-14-17(26-16-7-3-1-4-8-16)10-9-15(18)13-19-20(25)23-21(27-19)24-11-5-2-6-12-24/h1,3-4,7-10,13-14H,2,5-6,11-12H2/b19-13+ |
| InChIKey | RFSGVSAVFZKBNK-CPNJWEJPSA-N |
| XLogP | 5.59 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one?
The IUPAC name of (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one (CID 51065871) is (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one.
What is the SMILES notation for (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one?
The canonical SMILES for (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one is O=C1N=C(N2CCCCC2)S/C1=C/c1ccc(Oc2ccccc2)cc1Cl.
What is the InChIKey of (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one?
The InChIKey is RFSGVSAVFZKBNK-CPNJWEJPSA-N. The full InChI is InChI=1S/C21H19ClN2O2S/c22-18-14-17(26-16-7-3-1-4-8-16)10-9-15(18)13-19-20(25)23-21(27-19)24-11-5-2-6-12-24/h1,3-4,7-10,13-14H,2,5-6,11-12H2/b19-13+.
What are the key properties of (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one?
(5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one has a molecular weight of 398.92 g/mol, XLogP of 5.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(2-chloro-4-phenoxyphenyl)methylidene]-2-piperidin-1-yl-1,3-thiazol-4-one is sourced from PubChem (CID 51065871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).