About 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one
4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one (PubChem CID 51066312) has the molecular formula C5H5ClN2O2
and a molecular weight of 160.56 g/mol. Its IUPAC name is 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one.
Molecular Properties
| Compound Name | 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one |
| PubChem CID | 51066312 |
| Molecular Formula | C5H5ClN2O2 |
| Molecular Weight | 160.56 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one |
| SMILES | O=C(CCl)c1c[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C5H5ClN2O2/c6-1-4(9)3-2-7-5(10)8-3/h2H,1H2,(H2,7,8,10) |
| InChIKey | OLVZLVOPHUCCAM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.56 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one?
The IUPAC name of 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one (CID 51066312) is 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one.
What is the SMILES notation for 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one?
The canonical SMILES for 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one is O=C(CCl)c1c[nH]c(=O)[nH]1.
What is the InChIKey of 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one?
The InChIKey is OLVZLVOPHUCCAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2O2/c6-1-4(9)3-2-7-5(10)8-3/h2H,1H2,(H2,7,8,10).
What are the key properties of 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one?
4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one has a molecular weight of 160.56 g/mol, XLogP of 0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroacetyl)-1,3-dihydroimidazol-2-one is sourced from PubChem (CID 51066312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).