C22H22O7 — CID 5106638
ethyl 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate (PubChem CID 5106638) has the molecular formula C22H22O7 and a molecular weight of 398.41 g/mol. Its IUPAC name is ethyl 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate.
| Compound Name | ethyl 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
|---|---|
| PubChem CID | 5106638 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl 2-[[2-[(2,3-dimethoxyphenyl)methylidene]-3-oxo-1-benzofuran-6-yl]oxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1ccc2c(c1)OC(=Cc1cccc(OC)c1OC)C2=O |
| InChI | InChI=1S/C22H22O7/c1-5-27-22(24)13(2)28-15-9-10-16-18(12-15)29-19(20(16)23)11-14-7-6-8-17(25-3)21(14)26-4/h6-13H,5H2,1-4H3 |
| InChIKey | KPEAYAPUFVLCFZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|