C23H27ClN4O2 — CID 51069590
1-[[5-(4-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]-3-ethyl-1-propan-2-ylurea (PubChem CID 51069590) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 1-[[5-(4-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]-3-ethyl-1-propan-2-ylurea.
| Compound Name | 1-[[5-(4-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]-3-ethyl-1-propan-2-ylurea |
|---|---|
| PubChem CID | 51069590 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-[[5-(4-chlorophenoxy)-3-methyl-1-phenylpyrazol-4-yl]methyl]-3-ethyl-1-propan-2-ylurea |
| SMILES | CCNC(=O)N(Cc1c(C)nn(-c2ccccc2)c1Oc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C23H27ClN4O2/c1-5-25-23(29)27(16(2)3)15-21-17(4)26-28(19-9-7-6-8-10-19)22(21)30-20-13-11-18(24)12-14-20/h6-14,16H,5,15H2,1-4H3,(H,25,29) |
| InChIKey | APSMUNACROVISO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |