C24H29FN4O2 — CID 51069865
1-[[5-(3-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]-1-propan-2-yl-3-propylurea (PubChem CID 51069865) has the molecular formula C24H29FN4O2 and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[[5-(3-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]-1-propan-2-yl-3-propylurea.
| Compound Name | 1-[[5-(3-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]-1-propan-2-yl-3-propylurea |
|---|---|
| PubChem CID | 51069865 |
| Molecular Formula | C24H29FN4O2 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-[[5-(3-fluorophenoxy)-1-methyl-3-phenylpyrazol-4-yl]methyl]-1-propan-2-yl-3-propylurea |
| SMILES | CCCNC(=O)N(Cc1c(-c2ccccc2)nn(C)c1Oc1cccc(F)c1)C(C)C |
| InChI | InChI=1S/C24H29FN4O2/c1-5-14-26-24(30)29(17(2)3)16-21-22(18-10-7-6-8-11-18)27-28(4)23(21)31-20-13-9-12-19(25)15-20/h6-13,15,17H,5,14,16H2,1-4H3,(H,26,30) |
| InChIKey | SDXYRIVHDWDWKM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |