2-(1,1-dioxothian-4-yl)acetic acid

C7H12O4S — CID 51072218

IUPAC2-(1,1-dioxothian-4-yl)acetic acid
SMILESO=C(O)CC1CCS(=O)(=O)CC1
InChIInChI=1S/C7H12O4S/c8-7(9)5-6-1-3-12(10,11)4-2-6/h6H,1-5H2,(H,8,9)
InChIKeyZNKGPJTYNUEAKE-UHFFFAOYSA-N
MW192.24 g/mol
LogP0.29
Rot. Bonds2

About 2-(1,1-dioxothian-4-yl)acetic acid

2-(1,1-dioxothian-4-yl)acetic acid (PubChem CID 51072218) has the molecular formula C7H12O4S and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1,1-dioxothian-4-yl)acetic acid
PubChem CID51072218
Molecular FormulaC7H12O4S
Molecular Weight192.24 g/mol
Exact Mass192.05
IUPAC Name2-(1,1-dioxothian-4-yl)acetic acid
SMILESO=C(O)CC1CCS(=O)(=O)CC1
InChIInChI=1S/C7H12O4S/c8-7(9)5-6-1-3-12(10,11)4-2-6/h6H,1-5H2,(H,8,9)
InChIKeyZNKGPJTYNUEAKE-UHFFFAOYSA-N
XLogP0.29
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.24
LogP ≤ 50.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(1,1-dioxothian-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,1-dioxothian-4-yl)acetic acid?
The IUPAC name of 2-(1,1-dioxothian-4-yl)acetic acid (CID 51072218) is 2-(1,1-dioxothian-4-yl)acetic acid.
What is the SMILES notation for 2-(1,1-dioxothian-4-yl)acetic acid?
The canonical SMILES for 2-(1,1-dioxothian-4-yl)acetic acid is O=C(O)CC1CCS(=O)(=O)CC1.
What is the InChIKey of 2-(1,1-dioxothian-4-yl)acetic acid?
The InChIKey is ZNKGPJTYNUEAKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4S/c8-7(9)5-6-1-3-12(10,11)4-2-6/h6H,1-5H2,(H,8,9).
What are the key properties of 2-(1,1-dioxothian-4-yl)acetic acid?
2-(1,1-dioxothian-4-yl)acetic acid has a molecular weight of 192.24 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothian-4-yl)acetic acid is sourced from PubChem (CID 51072218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).