About 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide
3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 51072261) has the molecular formula C5H9N5O
and a molecular weight of 155.16 g/mol. Its IUPAC name is 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide.
Analyze 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide (CID 51072261) is 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide is CN(C)C(=O)c1nc(N)n[nH]1.
What is the InChIKey of 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is LHFFZPOUFUWQOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5O/c1-10(2)4(11)3-7-5(6)9-8-3/h1-2H3,(H3,6,7,8,9).
What are the key properties of 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide?
3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 155.16 g/mol, XLogP of -0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 51072261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).