About 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole
6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (PubChem CID 51072271) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
Analyze 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole (CID 51072271) is 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole is c1nnc2n1CCC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
The InChIKey is BRXYDRIZVHRXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3/c1-2-5-7-6-4-8(5)3-1/h4H,1-3H2.
What are the key properties of 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole?
6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole has a molecular weight of 109.13 g/mol, XLogP of 0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazole is sourced from PubChem (CID 51072271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).