C11H18N2O2 — CID 51073384
N,N,3-triethyl-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 51073384) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N,N,3-triethyl-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N,N,3-triethyl-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 51073384 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N,N,3-triethyl-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCc1noc(C)c1C(=O)N(CC)CC |
| InChI | InChI=1S/C11H18N2O2/c1-5-9-10(8(4)15-12-9)11(14)13(6-2)7-3/h5-7H2,1-4H3 |
| InChIKey | RCKZIVAVGLBEMG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |