About 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide
4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide (PubChem CID 51073960) has the molecular formula C7H8F3N3OS
and a molecular weight of 239.22 g/mol. Its IUPAC name is 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide |
| PubChem CID | 51073960 |
| Molecular Formula | C7H8F3N3OS |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H8F3N3OS/c1-2-4-5(15-13-12-4)6(14)11-3-7(8,9)10/h2-3H2,1H3,(H,11,14) |
| InChIKey | YLGLMWMZUKJTLW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide?
The IUPAC name of 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide (CID 51073960) is 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide.
What is the SMILES notation for 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide?
The canonical SMILES for 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide is CCc1nnsc1C(=O)NCC(F)(F)F.
What is the InChIKey of 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide?
The InChIKey is YLGLMWMZUKJTLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3OS/c1-2-4-5(15-13-12-4)6(14)11-3-7(8,9)10/h2-3H2,1H3,(H,11,14).
What are the key properties of 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide?
4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide has a molecular weight of 239.22 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-(2,2,2-trifluoroethyl)thiadiazole-5-carboxamide is sourced from PubChem (CID 51073960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).