About 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one
3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one (PubChem CID 51074625) has the molecular formula C16H18FNO2
and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one.
Molecular Properties
| Compound Name | 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one |
| PubChem CID | 51074625 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one |
| SMILES | CC1CC(N2CC=C(c3ccc(F)cc3)CC2)C(=O)O1 |
| InChI | InChI=1S/C16H18FNO2/c1-11-10-15(16(19)20-11)18-8-6-13(7-9-18)12-2-4-14(17)5-3-12/h2-6,11,15H,7-10H2,1H3 |
| InChIKey | MNZDJPYFOHJXOO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one?
The IUPAC name of 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one (CID 51074625) is 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one.
What is the SMILES notation for 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one?
The canonical SMILES for 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one is CC1CC(N2CC=C(c3ccc(F)cc3)CC2)C(=O)O1.
What is the InChIKey of 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one?
The InChIKey is MNZDJPYFOHJXOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO2/c1-11-10-15(16(19)20-11)18-8-6-13(7-9-18)12-2-4-14(17)5-3-12/h2-6,11,15H,7-10H2,1H3.
What are the key properties of 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one?
3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one has a molecular weight of 275.32 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-fluorophenyl)-3,6-dihydro-2H-pyridin-1-yl]-5-methyloxolan-2-one is sourced from PubChem (CID 51074625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).