About N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine
N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine (PubChem CID 51074630) has the molecular formula C15H27N3O3S
and a molecular weight of 329.47 g/mol. Its IUPAC name is N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine |
| PubChem CID | 51074630 |
| Molecular Formula | C15H27N3O3S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine |
| SMILES | CCOc1c(CNC2CCS(=O)(=O)C2)c(C)nn1CC(C)C |
| InChI | InChI=1S/C15H27N3O3S/c1-5-21-15-14(12(4)17-18(15)9-11(2)3)8-16-13-6-7-22(19,20)10-13/h11,13,16H,5-10H2,1-4H3 |
| InChIKey | UCJZQKQPAOVNBY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine?
The IUPAC name of N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine (CID 51074630) is N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine is CCOc1c(CNC2CCS(=O)(=O)C2)c(C)nn1CC(C)C.
What is the InChIKey of N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine?
The InChIKey is UCJZQKQPAOVNBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O3S/c1-5-21-15-14(12(4)17-18(15)9-11(2)3)8-16-13-6-7-22(19,20)10-13/h11,13,16H,5-10H2,1-4H3.
What are the key properties of N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine?
N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine has a molecular weight of 329.47 g/mol, XLogP of 1.52, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-ethoxy-3-methyl-1-(2-methylpropyl)pyrazol-4-yl]methyl]-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 51074630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).