C18H27N5O2 — CID 51074664
1-methyl-3-(3-propan-2-yloxypropyl)-1-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea (PubChem CID 51074664) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-methyl-3-(3-propan-2-yloxypropyl)-1-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea.
| Compound Name | 1-methyl-3-(3-propan-2-yloxypropyl)-1-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 51074664 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-methyl-3-(3-propan-2-yloxypropyl)-1-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea |
| SMILES | CC(C)OCCCNC(=O)N(C)C(C)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H27N5O2/c1-14(2)25-11-5-10-20-18(24)22(4)15(3)16-6-8-17(9-7-16)23-13-19-12-21-23/h6-9,12-15H,5,10-11H2,1-4H3,(H,20,24) |
| InChIKey | HYVOVMRWMSUDNG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|