About 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione
6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 51074719) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione |
| PubChem CID | 51074719 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1c(CN2CCCCCCC2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H23N3O2/c1-15-12(10-13(18)16(2)14(15)19)11-17-8-6-4-3-5-7-9-17/h10H,3-9,11H2,1-2H3 |
| InChIKey | UDXWFIKKNYKAEJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione?
The IUPAC name of 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione (CID 51074719) is 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione.
What is the SMILES notation for 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione?
The canonical SMILES for 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione is Cn1c(CN2CCCCCCC2)cc(=O)n(C)c1=O.
What is the InChIKey of 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione?
The InChIKey is UDXWFIKKNYKAEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-15-12(10-13(18)16(2)14(15)19)11-17-8-6-4-3-5-7-9-17/h10H,3-9,11H2,1-2H3.
What are the key properties of 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione?
6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione has a molecular weight of 265.36 g/mol, XLogP of 0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(azocan-1-ylmethyl)-1,3-dimethylpyrimidine-2,4-dione is sourced from PubChem (CID 51074719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).