About 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione
6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione (PubChem CID 51074860) has the molecular formula C14H18F3N3O3
and a molecular weight of 333.31 g/mol. Its IUPAC name is 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 51074860 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C14H18F3N3O3/c1-8-10(12(22)19-13(23)18-8)4-5-11(21)20-6-2-3-9(7-20)14(15,16)17/h9H,2-7H2,1H3,(H2,18,19,22,23) |
| InChIKey | OJGKEQQVXDAQNY-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione (CID 51074860) is 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione is Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)N1CCCC(C(F)(F)F)C1.
What is the InChIKey of 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione?
The InChIKey is OJGKEQQVXDAQNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3N3O3/c1-8-10(12(22)19-13(23)18-8)4-5-11(21)20-6-2-3-9(7-20)14(15,16)17/h9H,2-7H2,1H3,(H2,18,19,22,23).
What are the key properties of 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione?
6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione has a molecular weight of 333.31 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-[3-oxo-3-[3-(trifluoromethyl)piperidin-1-yl]propyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 51074860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).