About (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide (PubChem CID 51075137) has the molecular formula C13H20N2OS
and a molecular weight of 252.38 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide |
| PubChem CID | 51075137 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide |
| SMILES | CCCN(CCC)C(=O)/C=C/c1csc(C)n1 |
| InChI | InChI=1S/C13H20N2OS/c1-4-8-15(9-5-2)13(16)7-6-12-10-17-11(3)14-12/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | ZXEXNKKZDCRHDH-VOTSOKGWSA-N |
| XLogP | 3.11 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide?
The IUPAC name of (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide (CID 51075137) is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide.
What is the SMILES notation for (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide?
The canonical SMILES for (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide is CCCN(CCC)C(=O)/C=C/c1csc(C)n1.
What is the InChIKey of (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide?
The InChIKey is ZXEXNKKZDCRHDH-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H20N2OS/c1-4-8-15(9-5-2)13(16)7-6-12-10-17-11(3)14-12/h6-7,10H,4-5,8-9H2,1-3H3/b7-6+.
What are the key properties of (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide?
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide has a molecular weight of 252.38 g/mol, XLogP of 3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(2-methyl-1,3-thiazol-4-yl)-N,N-dipropylprop-2-enamide is sourced from PubChem (CID 51075137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).