About N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine
N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine (PubChem CID 51075144) has the molecular formula C13H16FN5O2S
and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 51075144 |
| Molecular Formula | C13H16FN5O2S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine |
| SMILES | CN(Cn1nnc(-c2ccc(F)cc2)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16FN5O2S/c1-18(12-6-7-22(20,21)8-12)9-19-16-13(15-17-19)10-2-4-11(14)5-3-10/h2-5,12H,6-9H2,1H3 |
| InChIKey | AJMTVQQTPSNHQO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The IUPAC name of N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine (CID 51075144) is N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine is CN(Cn1nnc(-c2ccc(F)cc2)n1)C1CCS(=O)(=O)C1.
What is the InChIKey of N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
The InChIKey is AJMTVQQTPSNHQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FN5O2S/c1-18(12-6-7-22(20,21)8-12)9-19-16-13(15-17-19)10-2-4-11(14)5-3-10/h2-5,12H,6-9H2,1H3.
What are the key properties of N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine?
N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine has a molecular weight of 325.37 g/mol, XLogP of 0.56, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(4-fluorophenyl)tetrazol-2-yl]methyl]-N-methyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 51075144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).