C15H23N5O — CID 51075235
1-[2-(cyclohexen-1-yl)ethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea (PubChem CID 51075235) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea |
|---|---|
| PubChem CID | 51075235 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)urea |
| SMILES | O=C(NCCC1=CCCCC1)NCc1nnc2n1CCC2 |
| InChI | InChI=1S/C15H23N5O/c21-15(16-9-8-12-5-2-1-3-6-12)17-11-14-19-18-13-7-4-10-20(13)14/h5H,1-4,6-11H2,(H2,16,17,21) |
| InChIKey | IEDUYVNCMWMPPT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|