About 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one
1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 51075308) has the molecular formula C15H18F3N3O3
and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 51075308 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(=O)N1CCCN(C(=O)Cn2cc(C(F)(F)F)ccc2=O)CC1 |
| InChI | InChI=1S/C15H18F3N3O3/c1-11(22)19-5-2-6-20(8-7-19)14(24)10-21-9-12(15(16,17)18)3-4-13(21)23/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | CXAXCYWJVINPPF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one (CID 51075308) is 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one is CC(=O)N1CCCN(C(=O)Cn2cc(C(F)(F)F)ccc2=O)CC1.
What is the InChIKey of 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
The InChIKey is CXAXCYWJVINPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F3N3O3/c1-11(22)19-5-2-6-20(8-7-19)14(24)10-21-9-12(15(16,17)18)3-4-13(21)23/h3-4,9H,2,5-8,10H2,1H3.
What are the key properties of 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one?
1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one has a molecular weight of 345.32 g/mol, XLogP of 0.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-acetyl-1,4-diazepan-1-yl)-2-oxoethyl]-5-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 51075308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).