About 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one
1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one (PubChem CID 51075690) has the molecular formula C18H21N3O4
and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one |
| PubChem CID | 51075690 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one |
| SMILES | CC(=O)N1CCCN(C(=O)c2ccc(Cn3ccccc3=O)o2)CC1 |
| InChI | InChI=1S/C18H21N3O4/c1-14(22)19-9-4-10-20(12-11-19)18(24)16-7-6-15(25-16)13-21-8-3-2-5-17(21)23/h2-3,5-8H,4,9-13H2,1H3 |
| InChIKey | DTBWGPISOPQLKP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one?
The IUPAC name of 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one (CID 51075690) is 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one.
What is the SMILES notation for 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one?
The canonical SMILES for 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one is CC(=O)N1CCCN(C(=O)c2ccc(Cn3ccccc3=O)o2)CC1.
What is the InChIKey of 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one?
The InChIKey is DTBWGPISOPQLKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O4/c1-14(22)19-9-4-10-20(12-11-19)18(24)16-7-6-15(25-16)13-21-8-3-2-5-17(21)23/h2-3,5-8H,4,9-13H2,1H3.
What are the key properties of 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one?
1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one has a molecular weight of 343.38 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(4-acetyl-1,4-diazepane-1-carbonyl)furan-2-yl]methyl]pyridin-2-one is sourced from PubChem (CID 51075690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).