C14H25NO — CID 51075788
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentan-1-one (PubChem CID 51075788) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentan-1-one.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 51075788 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)pentan-1-one |
| SMILES | CCCCC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C14H25NO/c1-2-3-10-14(16)15-11-6-8-12-7-4-5-9-13(12)15/h12-13H,2-11H2,1H3 |
| InChIKey | HRZFFGWACTTYAH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |