About 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide
2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide (PubChem CID 51075868) has the molecular formula C12H20N2OS
and a molecular weight of 240.37 g/mol. Its IUPAC name is 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 51075868 |
| Molecular Formula | C12H20N2OS |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C12H20N2OS/c1-5-7-14(8-6-2)12(15)11-9(3)13-10(4)16-11/h5-8H2,1-4H3 |
| InChIKey | LUNKJWDFWBFMIH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide (CID 51075868) is 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide is CCCN(CCC)C(=O)c1sc(C)nc1C.
What is the InChIKey of 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide?
The InChIKey is LUNKJWDFWBFMIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2OS/c1-5-7-14(8-6-2)12(15)11-9(3)13-10(4)16-11/h5-8H2,1-4H3.
What are the key properties of 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide?
2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide has a molecular weight of 240.37 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-N,N-dipropyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 51075868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).