About N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline
N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline (PubChem CID 51075886) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline.
Molecular Properties
| Compound Name | N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline |
| PubChem CID | 51075886 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline |
| SMILES | Cc1noc(CN(C)c2ccccc2)n1 |
| InChI | InChI=1S/C11H13N3O/c1-9-12-11(15-13-9)8-14(2)10-6-4-3-5-7-10/h3-7H,8H2,1-2H3 |
| InChIKey | QZSDGXZJSRBJOF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline?
The IUPAC name of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline (CID 51075886) is N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline.
What is the SMILES notation for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline?
The canonical SMILES for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline is Cc1noc(CN(C)c2ccccc2)n1.
What is the InChIKey of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline?
The InChIKey is QZSDGXZJSRBJOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-9-12-11(15-13-9)8-14(2)10-6-4-3-5-7-10/h3-7H,8H2,1-2H3.
What are the key properties of N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline?
N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline has a molecular weight of 203.25 g/mol, XLogP of 2.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]aniline is sourced from PubChem (CID 51075886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).