About 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine
4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine (PubChem CID 51076067) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine.
Molecular Properties
| Compound Name | 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine |
| PubChem CID | 51076067 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine |
| SMILES | CCc1noc(C(C)N2CCOCC2)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-3-9-11-10(15-12-9)8(2)13-4-6-14-7-5-13/h8H,3-7H2,1-2H3 |
| InChIKey | GQWGSLZXAIMPHJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine?
The IUPAC name of 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine (CID 51076067) is 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine.
What is the SMILES notation for 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine?
The canonical SMILES for 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine is CCc1noc(C(C)N2CCOCC2)n1.
What is the InChIKey of 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine?
The InChIKey is GQWGSLZXAIMPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-3-9-11-10(15-12-9)8(2)13-4-6-14-7-5-13/h8H,3-7H2,1-2H3.
What are the key properties of 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine?
4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine has a molecular weight of 211.26 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethyl]morpholine is sourced from PubChem (CID 51076067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).