C12H21N3O — CID 51076097
1,5-dimethyl-N,N-dipropylpyrazole-4-carboxamide (PubChem CID 51076097) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1,5-dimethyl-N,N-dipropylpyrazole-4-carboxamide.
| Compound Name | 1,5-dimethyl-N,N-dipropylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 51076097 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1,5-dimethyl-N,N-dipropylpyrazole-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cnn(C)c1C |
| InChI | InChI=1S/C12H21N3O/c1-5-7-15(8-6-2)12(16)11-9-13-14(4)10(11)3/h9H,5-8H2,1-4H3 |
| InChIKey | VYDBUDRYOBLDCN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |