About N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide
N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide (PubChem CID 51076099) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide |
| PubChem CID | 51076099 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide |
| SMILES | COCCN(CCOC)C(=O)c1cnn(C)c1C |
| InChI | InChI=1S/C12H21N3O3/c1-10-11(9-13-14(10)2)12(16)15(5-7-17-3)6-8-18-4/h9H,5-8H2,1-4H3 |
| InChIKey | OKJIPFZVSVBTBF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide?
The IUPAC name of N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide (CID 51076099) is N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide.
What is the SMILES notation for N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide?
The canonical SMILES for N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide is COCCN(CCOC)C(=O)c1cnn(C)c1C.
What is the InChIKey of N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide?
The InChIKey is OKJIPFZVSVBTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-10-11(9-13-14(10)2)12(16)15(5-7-17-3)6-8-18-4/h9H,5-8H2,1-4H3.
What are the key properties of N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide?
N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide has a molecular weight of 255.32 g/mol, XLogP of 0.46, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-methoxyethyl)-1,5-dimethylpyrazole-4-carboxamide is sourced from PubChem (CID 51076099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).