About 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane
1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane (PubChem CID 51076398) has the molecular formula C16H26N2O3S
and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane |
| PubChem CID | 51076398 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane |
| SMILES | Cc1cc(C)cc(OCCN2CCCN(S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C16H26N2O3S/c1-14-11-15(2)13-16(12-14)21-10-9-17-5-4-6-18(8-7-17)22(3,19)20/h11-13H,4-10H2,1-3H3 |
| InChIKey | UKZJBXGRWBSHTH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane?
The IUPAC name of 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane (CID 51076398) is 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane.
What is the SMILES notation for 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane?
The canonical SMILES for 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane is Cc1cc(C)cc(OCCN2CCCN(S(C)(=O)=O)CC2)c1.
What is the InChIKey of 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane?
The InChIKey is UKZJBXGRWBSHTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3S/c1-14-11-15(2)13-16(12-14)21-10-9-17-5-4-6-18(8-7-17)22(3,19)20/h11-13H,4-10H2,1-3H3.
What are the key properties of 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane?
1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane has a molecular weight of 326.46 g/mol, XLogP of 1.65, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,5-dimethylphenoxy)ethyl]-4-methylsulfonyl-1,4-diazepane is sourced from PubChem (CID 51076398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).