C11H13N3O2 — CID 51076543
3-(furan-2-yl)-5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazole (PubChem CID 51076543) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(furan-2-yl)-5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 51076543 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-(furan-2-yl)-5-(pyrrolidin-1-ylmethyl)-1,2,4-oxadiazole |
| SMILES | c1coc(-c2noc(CN3CCCC3)n2)c1 |
| InChI | InChI=1S/C11H13N3O2/c1-2-6-14(5-1)8-10-12-11(13-16-10)9-4-3-7-15-9/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | UWBNVPHTOLFNNG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |