C16H20N2O2 — CID 51076546
4-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]morpholine (PubChem CID 51076546) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]morpholine.
| Compound Name | 4-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 51076546 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]morpholine |
| SMILES | Cc1ccc(-c2nc(CN3CCOCC3)co2)c(C)c1 |
| InChI | InChI=1S/C16H20N2O2/c1-12-3-4-15(13(2)9-12)16-17-14(11-20-16)10-18-5-7-19-8-6-18/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | ZIZYOGFIKQSJDZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |