C17H23N5O — CID 51076591
N-(1-cyclopropylpiperidin-4-yl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 51076591) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(1-cyclopropylpiperidin-4-yl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-(1-cyclopropylpiperidin-4-yl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 51076591 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(1-cyclopropylpiperidin-4-yl)-1-methyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NC2CCN(C3CC3)CC2)c1-n1cccc1 |
| InChI | InChI=1S/C17H23N5O/c1-20-17(22-8-2-3-9-22)15(12-18-20)16(23)19-13-6-10-21(11-7-13)14-4-5-14/h2-3,8-9,12-14H,4-7,10-11H2,1H3,(H,19,23) |
| InChIKey | ULSQPOVOOBIVGX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |