About N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine
N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine (PubChem CID 51077057) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine.
Molecular Properties
| Compound Name | N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine |
| PubChem CID | 51077057 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine |
| SMILES | C=C(C)CN(CC)Cc1nc(C2CC2)no1 |
| InChI | InChI=1S/C12H19N3O/c1-4-15(7-9(2)3)8-11-13-12(14-16-11)10-5-6-10/h10H,2,4-8H2,1,3H3 |
| InChIKey | KTQMCWYQYXSPME-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine?
The IUPAC name of N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine (CID 51077057) is N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine.
What is the SMILES notation for N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine?
The canonical SMILES for N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine is C=C(C)CN(CC)Cc1nc(C2CC2)no1.
What is the InChIKey of N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine?
The InChIKey is KTQMCWYQYXSPME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-4-15(7-9(2)3)8-11-13-12(14-16-11)10-5-6-10/h10H,2,4-8H2,1,3H3.
What are the key properties of N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine?
N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine has a molecular weight of 221.30 g/mol, XLogP of 2.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-N-ethyl-2-methylprop-2-en-1-amine is sourced from PubChem (CID 51077057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).