About N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide
N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide (PubChem CID 51077165) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide |
| PubChem CID | 51077165 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C(C)CC(C)C)on1 |
| InChI | InChI=1S/C12H20N2O2/c1-8(2)6-10(4)14(5)12(15)11-7-9(3)13-16-11/h7-8,10H,6H2,1-5H3 |
| InChIKey | LFOUNKFBRQGWSJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide?
The IUPAC name of N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide (CID 51077165) is N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide?
The canonical SMILES for N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide is Cc1cc(C(=O)N(C)C(C)CC(C)C)on1.
What is the InChIKey of N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide?
The InChIKey is LFOUNKFBRQGWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2/c1-8(2)6-10(4)14(5)12(15)11-7-9(3)13-16-11/h7-8,10H,6H2,1-5H3.
What are the key properties of N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide?
N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide has a molecular weight of 224.30 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-N-(4-methylpentan-2-yl)-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 51077165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).