C11H19NO3 — CID 51078971
(2,2-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone (PubChem CID 51078971) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (2,2-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone.
| Compound Name | (2,2-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 51078971 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (2,2-dimethylmorpholin-4-yl)-(oxolan-2-yl)methanone |
| SMILES | CC1(C)CN(C(=O)C2CCCO2)CCO1 |
| InChI | InChI=1S/C11H19NO3/c1-11(2)8-12(5-7-15-11)10(13)9-4-3-6-14-9/h9H,3-8H2,1-2H3 |
| InChIKey | XIANXLNAGTVODG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |