About (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone
(4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 51079341) has the molecular formula C17H24N2O3S
and a molecular weight of 336.46 g/mol. Its IUPAC name is (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone.
Molecular Properties
| Compound Name | (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone |
| PubChem CID | 51079341 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CC1CCN(C(=O)C2CCN(S(C)(=O)=O)CC2)c2ccccc21 |
| InChI | InChI=1S/C17H24N2O3S/c1-13-7-12-19(16-6-4-3-5-15(13)16)17(20)14-8-10-18(11-9-14)23(2,21)22/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | IPJBCEUXXYYEKD-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone?
The IUPAC name of (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone (CID 51079341) is (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone.
What is the SMILES notation for (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone?
The canonical SMILES for (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone is CC1CCN(C(=O)C2CCN(S(C)(=O)=O)CC2)c2ccccc21.
What is the InChIKey of (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone?
The InChIKey is IPJBCEUXXYYEKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3S/c1-13-7-12-19(16-6-4-3-5-15(13)16)17(20)14-8-10-18(11-9-14)23(2,21)22/h3-6,13-14H,7-12H2,1-2H3.
What are the key properties of (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone?
(4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone has a molecular weight of 336.46 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-3,4-dihydro-2H-quinolin-1-yl)-(1-methylsulfonylpiperidin-4-yl)methanone is sourced from PubChem (CID 51079341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).