C15H24N4O — CID 51079892
(Z)-2-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pent-2-enamide (PubChem CID 51079892) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is (Z)-2-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pent-2-enamide.
| Compound Name | (Z)-2-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pent-2-enamide |
|---|---|
| PubChem CID | 51079892 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | (Z)-2-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]pent-2-enamide |
| SMILES | CC/C=C(/C)C(=O)NCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C15H24N4O/c1-3-7-12(2)15(20)16-10-9-14-18-17-13-8-5-4-6-11-19(13)14/h7H,3-6,8-11H2,1-2H3,(H,16,20)/b12-7- |
| InChIKey | IETIAZUSFKAETA-GHXNOFRVSA-N |
| XLogP | 2.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|