About N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide
N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide (PubChem CID 51079905) has the molecular formula C11H18F3NO
and a molecular weight of 237.26 g/mol. Its IUPAC name is N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide.
Molecular Properties
| Compound Name | N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide |
| PubChem CID | 51079905 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide |
| SMILES | CC(C)CCN(C(=O)CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C11H18F3NO/c1-8(2)5-6-15(9-3-4-9)10(16)7-11(12,13)14/h8-9H,3-7H2,1-2H3 |
| InChIKey | DLUGPOBVWNXPPJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide?
The IUPAC name of N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide (CID 51079905) is N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide.
What is the SMILES notation for N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide?
The canonical SMILES for N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide is CC(C)CCN(C(=O)CC(F)(F)F)C1CC1.
What is the InChIKey of N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide?
The InChIKey is DLUGPOBVWNXPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO/c1-8(2)5-6-15(9-3-4-9)10(16)7-11(12,13)14/h8-9H,3-7H2,1-2H3.
What are the key properties of N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide?
N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide has a molecular weight of 237.26 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3,3,3-trifluoro-N-(3-methylbutyl)propanamide is sourced from PubChem (CID 51079905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).