About 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea
1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea (PubChem CID 51080414) has the molecular formula C16H17N3O3S
and a molecular weight of 331.40 g/mol. Its IUPAC name is 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea |
| PubChem CID | 51080414 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea |
| SMILES | CN(Cc1ccsc1)C(=O)Nc1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-18(10-12-5-8-23-11-12)15(20)17-13-3-2-4-14(9-13)19-6-7-22-16(19)21/h2-5,8-9,11H,6-7,10H2,1H3,(H,17,20) |
| InChIKey | OUNQDUHSXKEXJL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea?
The IUPAC name of 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea (CID 51080414) is 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea.
What is the SMILES notation for 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea?
The canonical SMILES for 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea is CN(Cc1ccsc1)C(=O)Nc1cccc(N2CCOC2=O)c1.
What is the InChIKey of 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea?
The InChIKey is OUNQDUHSXKEXJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O3S/c1-18(10-12-5-8-23-11-12)15(20)17-13-3-2-4-14(9-13)19-6-7-22-16(19)21/h2-5,8-9,11H,6-7,10H2,1H3,(H,17,20).
What are the key properties of 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea?
1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea has a molecular weight of 331.40 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]-1-(thiophen-3-ylmethyl)urea is sourced from PubChem (CID 51080414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).