About 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid
4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid (PubChem CID 510807) has the molecular formula C15H12FNO4
and a molecular weight of 289.26 g/mol. Its IUPAC name is 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid.
Molecular Properties
| Compound Name | 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid |
| PubChem CID | 510807 |
| Molecular Formula | C15H12FNO4 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccn1Cc1ccccc1F |
| InChI | InChI=1S/C15H12FNO4/c16-11-5-2-1-4-10(11)9-17-7-3-6-12(17)13(18)8-14(19)15(20)21/h1-7H,8-9H2,(H,20,21) |
| InChIKey | YPTGEIHLIGWFAE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid?
The IUPAC name of 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid (CID 510807) is 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid.
What is the SMILES notation for 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid?
The canonical SMILES for 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid is O=C(O)C(=O)CC(=O)c1cccn1Cc1ccccc1F.
What is the InChIKey of 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid?
The InChIKey is YPTGEIHLIGWFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FNO4/c16-11-5-2-1-4-10(11)9-17-7-3-6-12(17)13(18)8-14(19)15(20)21/h1-7H,8-9H2,(H,20,21).
What are the key properties of 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid?
4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid has a molecular weight of 289.26 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]-2,4-dioxobutanoic acid is sourced from PubChem (CID 510807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).