About N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide
N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 51080851) has the molecular formula C11H16N2OS
and a molecular weight of 224.33 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 51080851 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)N(C)C(C)C1CC1 |
| InChI | InChI=1S/C11H16N2OS/c1-7-10(15-6-12-7)11(14)13(3)8(2)9-4-5-9/h6,8-9H,4-5H2,1-3H3 |
| InChIKey | BVKVTOXEFCBBBM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide (CID 51080851) is N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is Cc1ncsc1C(=O)N(C)C(C)C1CC1.
What is the InChIKey of N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
The InChIKey is BVKVTOXEFCBBBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2OS/c1-7-10(15-6-12-7)11(14)13(3)8(2)9-4-5-9/h6,8-9H,4-5H2,1-3H3.
What are the key properties of N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide?
N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide has a molecular weight of 224.33 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopropylethyl)-N,4-dimethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 51080851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).