About 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide
1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide (PubChem CID 51081092) has the molecular formula C17H24N2O3
and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide |
| PubChem CID | 51081092 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CCCC1C(=O)NCCOc1c(C)cccc1C |
| InChI | InChI=1S/C17H24N2O3/c1-12-6-4-7-13(2)16(12)22-11-9-18-17(21)15-8-5-10-19(15)14(3)20/h4,6-7,15H,5,8-11H2,1-3H3,(H,18,21) |
| InChIKey | HDVXTTIZMCVVCR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide?
The IUPAC name of 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide (CID 51081092) is 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide.
What is the SMILES notation for 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide?
The canonical SMILES for 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide is CC(=O)N1CCCC1C(=O)NCCOc1c(C)cccc1C.
What is the InChIKey of 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide?
The InChIKey is HDVXTTIZMCVVCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O3/c1-12-6-4-7-13(2)16(12)22-11-9-18-17(21)15-8-5-10-19(15)14(3)20/h4,6-7,15H,5,8-11H2,1-3H3,(H,18,21).
What are the key properties of 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide?
1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide has a molecular weight of 304.39 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-[2-(2,6-dimethylphenoxy)ethyl]pyrrolidine-2-carboxamide is sourced from PubChem (CID 51081092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).