C19H17N3O2 — CID 51081134
(3-phenyl-1,2-oxazol-5-yl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 51081134) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 51081134 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)-(2-pyridin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)no1)N1CCCC1c1ccncc1 |
| InChI | InChI=1S/C19H17N3O2/c23-19(18-13-16(21-24-18)14-5-2-1-3-6-14)22-12-4-7-17(22)15-8-10-20-11-9-15/h1-3,5-6,8-11,13,17H,4,7,12H2 |
| InChIKey | KSHQJUVTEQCZIW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |