C15H21N5O2 — CID 51081163
1-(cyclopropylmethyl)-5-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide (PubChem CID 51081163) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-5-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-5-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51081163 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-(cyclopropylmethyl)-5-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCNc1ncccn1)C1CC(=O)N(CC2CC2)C1 |
| InChI | InChI=1S/C15H21N5O2/c21-13-8-12(10-20(13)9-11-2-3-11)14(22)16-6-7-19-15-17-4-1-5-18-15/h1,4-5,11-12H,2-3,6-10H2,(H,16,22)(H,17,18,19) |
| InChIKey | HKNLWEXNYPKESB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|