About 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide (PubChem CID 51082534) has the molecular formula C16H27N3O3
and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide |
| PubChem CID | 51082534 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide |
| SMILES | CCN(CC1CCOC1)C(=O)CCc1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C16H27N3O3/c1-5-19(10-12-8-9-21-11-12)14(20)7-6-13-17-15(18-22-13)16(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | WVSXFYDQTVSKAH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide?
The IUPAC name of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide (CID 51082534) is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide.
What is the SMILES notation for 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide?
The canonical SMILES for 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide is CCN(CC1CCOC1)C(=O)CCc1nc(C(C)(C)C)no1.
What is the InChIKey of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide?
The InChIKey is WVSXFYDQTVSKAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O3/c1-5-19(10-12-8-9-21-11-12)14(20)7-6-13-17-15(18-22-13)16(2,3)4/h12H,5-11H2,1-4H3.
What are the key properties of 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide?
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide has a molecular weight of 309.41 g/mol, XLogP of 2.18, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)-N-ethyl-N-(oxolan-3-ylmethyl)propanamide is sourced from PubChem (CID 51082534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).