About 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea
1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea (PubChem CID 51082705) has the molecular formula C15H28N6O2
and a molecular weight of 324.43 g/mol. Its IUPAC name is 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea.
Molecular Properties
| Compound Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea |
| PubChem CID | 51082705 |
| Molecular Formula | C15H28N6O2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea |
| SMILES | CCn1cnnc1CNC(=O)NCC(C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C15H28N6O2/c1-4-20-11-18-19-14(20)10-17-15(22)16-9-13(12(2)3)21-5-7-23-8-6-21/h11-13H,4-10H2,1-3H3,(H2,16,17,22) |
| InChIKey | UWGVRZPIYCXWER-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea?
The IUPAC name of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea (CID 51082705) is 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea.
What is the SMILES notation for 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea?
The canonical SMILES for 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea is CCn1cnnc1CNC(=O)NCC(C(C)C)N1CCOCC1.
What is the InChIKey of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea?
The InChIKey is UWGVRZPIYCXWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N6O2/c1-4-20-11-18-19-14(20)10-17-15(22)16-9-13(12(2)3)21-5-7-23-8-6-21/h11-13H,4-10H2,1-3H3,(H2,16,17,22).
What are the key properties of 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea?
1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea has a molecular weight of 324.43 g/mol, XLogP of 0.45, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3-(3-methyl-2-morpholin-4-ylbutyl)urea is sourced from PubChem (CID 51082705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).