About N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide
N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide (PubChem CID 51082889) has the molecular formula C9H17F3N2O3S
and a molecular weight of 290.31 g/mol. Its IUPAC name is N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide |
| PubChem CID | 51082889 |
| Molecular Formula | C9H17F3N2O3S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O3S/c1-3-18(16,17)14(2)6-4-5-13-8(15)7-9(10,11)12/h3-7H2,1-2H3,(H,13,15) |
| InChIKey | GNFODVFLXMMGAF-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide?
The IUPAC name of N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide (CID 51082889) is N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide?
The canonical SMILES for N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide is CCS(=O)(=O)N(C)CCCNC(=O)CC(F)(F)F.
What is the InChIKey of N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide?
The InChIKey is GNFODVFLXMMGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O3S/c1-3-18(16,17)14(2)6-4-5-13-8(15)7-9(10,11)12/h3-7H2,1-2H3,(H,13,15).
What are the key properties of N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide?
N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide has a molecular weight of 290.31 g/mol, XLogP of 0.73, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[ethylsulfonyl(methyl)amino]propyl]-3,3,3-trifluoropropanamide is sourced from PubChem (CID 51082889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).